Heptafluorobutyric Acid (Cat. No: R057752) is a kind of chemical intermediate, which can be used as a new type of medicine, gunpowder, and spice intermediate, as well as a raw material or additive for the synthesis of new organic polymer materials, and it can also be used as an organic solvent.
| Catalog Number | R057752 |
| CAS Number | 375-22-4 |
| Synonyms | 2,2,3,3,4,4,4-Heptafluorobutanoic Acid; Heptafluorobutanoic Acid; FC 23; Fluorad FC 23; H 0024; HFBA; Heptafluorobutanoic Acid; NSC 820; Perfluorobutanoic Acid; Perfluorobutyric Acid; Perfluoropropanecarboxylic Acid; |
| Molecular Formula | C4HF7O2 |
| Purity | 95% |
| Storage | Store at +4C |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid |
| InChI | InChI=1S/C4HF7O2/c5-2(6,1(12)13)3(7,8)4(9,10)11/h(H,12,13) |
| InChIKey | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O |
