Heptadecafluorooctanesulfonic acid (Cat No.:M121230) is a synthetic compound belonging to the class of per- and poly-fluoroalkyl substances (PFAS). It is a strong organic acid with the chemical formula C8HF17O3S. PFOS is known for its surfactant properties, making it useful in industrial applications such as the production of firefighting foams, metal plating, and the manufacture of semiconductors. However, PFOS is persistent in the environment, bioaccumulates in organisms, and is toxic to wildlife and humans.
| Catalog Number | M121230 |
| CAS Number | 1763-23-1 |
| Molecular Formula | C8HF17O3S |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonic acid |
| InChI | InChI=1S/C8HF17O3S/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28/h(H,26,27,28) |
| InChIKey | YFSUTJLHUFNCNZ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)S(=O)(=O)O)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
