For research use only. Not for therapeutic Use.
hENT4-IN-1（Cat No.:I009528）is a selective inhibitor targeting the human equilibrative nucleoside transporter 4 (hENT4), a protein involved in the transport of nucleosides across cell membranes. By inhibiting hENT4, this compound disrupts nucleoside uptake, which can affect cellular processes like DNA and RNA synthesis, and potentially induce cell death in certain cancer cells. hENT4-IN-1 is being studied for its potential use in cancer therapy, particularly for tumors that rely on high nucleoside transport for rapid proliferation. Further research and clinical trials are needed to evaluate its safety, efficacy, and potential therapeutic applications in oncology.
| CAS Number | 949467-71-4 |
| Synonyms | 2-[[4,8-bis[bis(2-methylpropyl)amino]-2-(2-hydroxyethylamino)pyrimido[5,4-d]pyrimidin-6-yl]amino]ethanol |
| Molecular Formula | C26H48N8O2 |
| Purity | ≥95% |
| IUPAC Name | 2-[[4,8-bis[bis(2-methylpropyl)amino]-2-(2-hydroxyethylamino)pyrimido[5,4-d]pyrimidin-6-yl]amino]ethanol |
| InChI | InChI=1S/C26H48N8O2/c1-17(2)13-33(14-18(3)4)23-21-22(30-25(31-23)27-9-11-35)24(32-26(29-21)28-10-12-36)34(15-19(5)6)16-20(7)8/h17-20,35-36H,9-16H2,1-8H3,(H,27,30,31)(H,28,29,32) |
| InChIKey | KIZLZYHFIWWKIL-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC(C)C)C1=NC(=NC2=C1N=C(N=C2N(CC(C)C)CC(C)C)NCCO)NCCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
