For research use only. Not for therapeutic Use.
Hellebrigenol（Cat No.:I044849）is a cardiotonic steroid belonging to the bufadienolide class, primarily isolated from plants in the Helleborus and Adonis genera. It features a steroidal backbone with a characteristic α-pyrone ring at the C-17 position, crucial for its biological activity. Hellebrigenol exhibits potent inhibitory effects on Na⁺/K⁺-ATPase, leading to increased intracellular calcium levels and enhanced cardiac contractility. While traditionally used for its cardiotonic properties, it also shows cytotoxic activity against cancer cells. Due to its narrow therapeutic window, hellebrigenol requires careful handling and further evaluation for clinical use.
| CAS Number | 508-79-2 |
| Synonyms | 5-[(3S,5S,8R,9S,10R,13R,14S,17R)-3,5,14-trihydroxy-10-(hydroxymethyl)-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
| Molecular Formula | C24H34O6 |
| Purity | ≥95% |
| IUPAC Name | 5-[(3S,5S,8R,9S,10R,13R,14S,17R)-3,5,14-trihydroxy-10-(hydroxymethyl)-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
| InChI | InChI=1S/C24H34O6/c1-21-8-5-18-19(6-10-23(28)12-16(26)4-9-22(18,23)14-25)24(21,29)11-7-17(21)15-2-3-20(27)30-13-15/h2-3,13,16-19,25-26,28-29H,4-12,14H2,1H3/t16-,17+,18-,19+,21+,22-,23-,24-/m0/s1 |
| InChIKey | ABVKNZHLRVHZSO-XHCIOXAKSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@]1(CC[C@@H]2C4=COC(=O)C=C4)O)CC[C@]5([C@@]3(CC[C@@H](C5)O)CO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
