For research use only. Not for therapeutic Use.
Helichrysetin(CAT: R003419) is a natural compound belonging to the class of flavonoids. Its action target involves various biological activities due to its complex chemical structure. The mode of action includes potential antioxidant, anti-inflammatory, and antimicrobial effects. Pharmacologically, Helichrysetin has shown promise in various medicinal applications, including its potential as an antioxidant agent to combat oxidative stress, its role in reducing inflammation, and its ability to exhibit antimicrobial activity against certain microorganisms. Additionally, it has been investigated for its potential in managing various inflammatory and infectious conditions.
| CAS Number | 62014-87-3 |
| Molecular Formula | C16H14O5 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | Store at -20°C |
| IUPAC Name | (E)-1-(2,4-dihydroxy-6-methoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| InChI | InChI=1S/C16H14O5/c1-21-15-9-12(18)8-14(20)16(15)13(19)7-4-10-2-5-11(17)6-3-10/h2-9,17-18,20H,1H3/b7-4+ |
| InChIKey | OWGUBYRKZATRIT-QPJJXVBHSA-N |
| SMILES | COC1=CC(=CC(=C1C(=O)C=CC2=CC=C(C=C2)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |