For research use only. Not for therapeutic Use.
HDAC6-IN-23(CAT: I040282), also known as compound 9, is a potent and orally active selective inhibitor of histone deacetylase 6 (HDAC6), an enzyme involved in the regulation of protein acetylation, intracellular transport, and aggresome formation. By selectively inhibiting HDAC6, this compound modulates non-histone substrates such as α-tubulin and Hsp90, contributing to anti-inflammatory, neuroprotective, and anticancer effects. HDAC6-IN-23 shows promising pharmacokinetics and bioavailability, making it suitable for in vivo studies. It serves as a valuable tool in epigenetic and neurological research, particularly for exploring protein homeostasis and neurodegenerative disease mechanisms.
| CAS Number | 2991427-09-7 |
| Synonyms | 2-(difluoromethyl)-5-[6-[(5-pyridin-2-yltetrazol-2-yl)methyl]pyridin-3-yl]-1,3,4-oxadiazole |
| Molecular Formula | C15H10F2N8O |
| Purity | ≥95% |
| IUPAC Name | 2-(difluoromethyl)-5-[6-[(5-pyridin-2-yltetrazol-2-yl)methyl]pyridin-3-yl]-1,3,4-oxadiazole |
| InChI | InChI=1S/C15H10F2N8O/c16-12(17)15-22-21-14(26-15)9-4-5-10(19-7-9)8-25-23-13(20-24-25)11-3-1-2-6-18-11/h1-7,12H,8H2 |
| InChIKey | ZTVLPDLCENUSAG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NN(N=N2)CC3=NC=C(C=C3)C4=NN=C(O4)C(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
