For research use only. Not for therapeutic Use.
HCV‑IN‑31（Cat No.:I044641）is a small‑molecule inhibitor targeting hepatitis C virus (HCV), specifically designed to block HCV replicon replication in vitro. It exhibits moderate antiviral activity with an EC₅₀/EC₉₅ around 15.7 µM, making it useful for early-stage research into HCV lifecycle and antiviral screening . Chemically, it has a molecular weight of 312.3 g/mol and formula C₁₂H₁₇FN₆O₃. Supplied as a solid (≥98% purity), it’s typically dissolved in DMSO (up to ~60 mg/mL) and stored cold. HCV‑IN‑31 is valuable as a tool compound for mechanistic antiviral studies and early‑stage drug discovery.
| CAS Number | 1998705-62-6 |
| Synonyms | (2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| Molecular Formula | C12H17FN6O3 |
| Purity | ≥95% |
| IUPAC Name | (2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| InChI | InChI=1S/C12H17FN6O3/c1-12(13)7(21)5(3-20)22-10(12)19-4-16-6-8(15-2)17-11(14)18-9(6)19/h4-5,7,10,20-21H,3H2,1-2H3,(H3,14,15,17,18)/t5-,7-,10-,12-/m1/s1 |
| InChIKey | HPINXBYYNVDDEB-GSWPYSDESA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=NC3=C(N=C(N=C32)N)NC)CO)O)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
