For research use only. Not for therapeutic Use.
HBTU (Cat No.:R059404) is a highly efficient coupling reagent widely used in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS). It promotes rapid and high-yielding amide bond formation with minimal racemization. HBTU activates carboxylic acids in the presence of a base, forming reactive intermediates suitable for peptide chain elongation and fragment condensation. Known for its solubility and stability in organic solvents, HBTU streamlines the synthesis of complex peptides and bioconjugates. Supplied at high purity, it is ideal for use in pharmaceutical development, combinatorial chemistry, and biochemical research.
| CAS Number | 94790-37-1 |
| Synonyms | 1-[Bis(dimethylamino)methylene]-1H-benzotriazolium Hexafluorophosphate(1-) 3-Oxide; N-HBTU; |
| Molecular Formula | C11H16F6N5OP |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium;hexafluorophosphate |
| InChI | InChI=1S/C11H16N5O.F6P/c1-14(2)11(15(3)4)17-16-10-8-6-5-7-9(10)12-13-16;1-7(2,3,4,5)6/h5-8H,1-4H3;/q+1;-1 |
| InChIKey | UQYZFNUUOSSNKT-UHFFFAOYSA-N |
| SMILES | CN(C)C(=[N+](C)C)ON1C2=CC=CC=C2N=N1.F[P-](F)(F)(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
