For research use only. Not for therapeutic Use.
Harmol（Cat No.:I028615）is a chemical compound known for its potential therapeutic effects, particularly in the field of neurology. It is a naturally occurring alkaloid found in certain plants, and research has suggested it may have neuroprotective properties. Harmol is being investigated for its ability to modulate the central nervous system, possibly aiding in the treatment of conditions like Parkinson’s disease or Alzheimer’s. Due to its impact on neurotransmitter systems, it may also have applications in mood disorders. However, further studies are necessary to fully understand its efficacy and safety profile.
| CAS Number | 487-03-6 |
| Synonyms | 1-methyl-2,9-dihydropyrido[3,4-b]indol-7-one |
| Molecular Formula | C12H10N2O |
| Purity | ≥95% |
| IUPAC Name | 1-methyl-2,9-dihydropyrido[3,4-b]indol-7-one |
| InChI | InChI=1S/C12H10N2O/c1-7-12-10(4-5-13-7)9-3-2-8(15)6-11(9)14-12/h2-6,13-14H,1H3 |
| InChIKey | LBBJNGFCXDOYMQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C3C=CC(=O)C=C3N2)C=CN1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
