For research use only. Not for therapeutic Use.
Harmalol hydrochloride（Cat No.:I044948）is a water-soluble salt form of harmalol, a β-carboline alkaloid derived from Peganum harmala (Syrian rue). It exhibits notable pharmacological properties, including anticancer, antioxidant, antimicrobial, and neuroprotective effects. Harmalol hydrochloride intercalates with DNA and disrupts topoisomerase activity, contributing to its cytotoxicity against cancer cells. Additionally, it modulates oxidative stress and protects neurons from degeneration, showing potential in neurodegenerative disease models. Its hydrochloride form enhances stability and bioavailability, making it a promising compound for drug development targeting cancer, microbial infections, and neurological disorders.
| CAS Number | 6028-07-5 |
| Synonyms | 1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indol-7-ol;hydrochloride |
| Molecular Formula | C12H13ClN2O |
| Purity | ≥95% |
| IUPAC Name | 1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indol-7-ol;hydrochloride |
| InChI | InChI=1S/C12H12N2O.ClH/c1-7-12-10(4-5-13-7)9-3-2-8(15)6-11(9)14-12;/h2-3,6,14-15H,4-5H2,1H3;1H |
| InChIKey | BSWAWVOHMZNXOS-UHFFFAOYSA-N |
| SMILES | CC1=NCCC2=C1NC3=C2C=CC(=C3)O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
