For research use only. Not for therapeutic Use.
H2S Donor 5a(Cat No.:R056315)is a chemical compound designed to release hydrogen sulfide (H2S) in a controlled manner, serving as a valuable tool in research on cellular signaling and physiology. H2S plays a crucial role in various biological processes, including vasodilation, neurotransmission, and inflammation. This donor allows researchers to study the effects of H2S in vivo and in vitro, helping to explore its potential therapeutic applications in cardiovascular diseases, neurodegenerative disorders, and inflammation. H2S Donor 5a’s controlled release mechanism ensures precise dosing, making it an essential reagent in biomedical research.
| CAS Number | 134861-13-5 |
| Synonyms | S-benzamido benzenecarbothioate |
| Molecular Formula | C14H11NO2S |
| Purity | ≥95% |
| IUPAC Name | S-benzamido benzenecarbothioate |
| InChI | InChI=1S/C14H11NO2S/c16-13(11-7-3-1-4-8-11)15-18-14(17)12-9-5-2-6-10-12/h1-10H,(H,15,16) |
| InChIKey | IJYATHJDICJZLJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NSC(=O)C2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |