For research use only. Not for therapeutic Use.
H-Ser-His-OH（Cat No.:I017864）is a dipeptide composed of serine and histidine, featuring a free amino group at the N-terminus and a carboxyl group at the C-terminus. The serine residue contributes a hydroxyl group, offering hydrogen-bonding and potential phosphorylation sites, while histidine provides an imidazole side chain with versatile acid–base properties. This dipeptide is valuable for studying peptide structure, enzyme catalysis, and biochemical interactions. H-Ser-His-OH also serves as a building block in peptide synthesis and a model compound in exploring protein–ligand binding and catalytic mechanisms.
| CAS Number | 67726-09-4 |
| Synonyms | (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| Molecular Formula | C9H14N4O4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| InChI | InChI=1S/C9H14N4O4/c10-6(3-14)8(15)13-7(9(16)17)1-5-2-11-4-12-5/h2,4,6-7,14H,1,3,10H2,(H,11,12)(H,13,15)(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | YZMPDHTZJJCGEI-BQBZGAKWSA-N |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)NC(=O)[C@H](CO)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
