For research use only. Not for therapeutic Use.
H-DL-Pro-OH-d3(Cat No.:S000710) is a deuterated form of DL-proline, where three hydrogen atoms are replaced with deuterium, increasing its molecular stability and making it an excellent internal standard for analytical methods such as mass spectrometry and NMR spectroscopy. DL-Proline is a racemic mixture of the L- and D-isomers of proline, a non-essential amino acid involved in protein synthesis. The introduction of deuterium in H-DL-Pro-OH-d3 enhances the precision of pharmacokinetic and metabolic studies, enabling more detailed investigation into the role and behavior of proline in various biological systems and peptide synthesis processes.
CAS Number | 784086-28-8 |
Molecular Formula | C5H6D3NO2 |
Purity | ≥95% |
IUPAC Name | 2,5,5-trideuteriopyrrolidine-2-carboxylic acid |
InChI | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/i3D2,4D |
InChIKey | ONIBWKKTOPOVIA-FBYXXYQPSA-N |
SMILES | C1CC(NC1)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |