For research use only. Not for therapeutic Use.
H-D-PHG-OMe HCl (Cat No.: 19883-41-1) is a derivative of D-phenylglycine, an unnatural amino acid featuring a methyl ester and existing in the D-configuration. It is commonly used in peptide synthesis as a chiral building block or intermediate in pharmaceutical research. The hydrochloride salt form enhances solubility and stability during synthesis. Its rigid structure and aromatic side chain contribute to bioactivity and molecular recognition in peptides or peptidomimetics. It is handled under standard peptide chemistry conditions.
CAS Number | 19883-41-1 |
Molecular Formula | C9H12ClNO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl (2R)-2-amino-2-phenylacetate;hydrochloride |
InChI | InChI=1S/C9H11NO2.ClH/c1-12-9(11)8(10)7-5-3-2-4-6-7;/h2-6,8H,10H2,1H3;1H/t8-;/m1./s1 |
InChIKey | DTHMTBUWTGVEFG-DDWIOCJRSA-N |
SMILES | COC(=O)C(C1=CC=CC=C1)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |