For research use only. Not for therapeutic Use.
H-D-Gly(allyl)-OH(Cat No.:R009890)is a modified derivative of the amino acid D-glycine, where the amino group is attached to an allyl group at the carboxyl position. This modification enhances its reactivity, allowing it to be used in organic synthesis, particularly in the preparation of peptides. The allyl group can be selectively removed under specific conditions, making this compound useful in solid-phase peptide synthesis (SPPS) and other biochemical applications. H-D-Gly(allyl)-OH is used to study peptide structure, enzyme activity, and can serve as a building block in the development of novel therapeutic peptides.
| CAS Number | 54594-06-8 |
| Synonyms | (2R)-2-aminopent-4-enoic acid |
| Molecular Formula | C5H9NO2 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-aminopent-4-enoic acid |
| InChI | InChI=1S/C5H9NO2/c1-2-3-4(6)5(7)8/h2,4H,1,3,6H2,(H,7,8)/t4-/m1/s1 |
| InChIKey | WNNNWFKQCKFSDK-SCSAIBSYSA-N |
| SMILES | C=CC[C@H](C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |