For research use only. Not for therapeutic Use.
Gymnemagenin is the aglycone core of gymnemic acids A and B, triterpenoid sweetness inhibitors derived from <em>G. sylvestre</em>. It is used as a biomarker for the quantification of gymnemic acids in medicinal plant extracts.
| CAS Number | 22467-07-8 |
| Synonyms | Olean-12-ene-3β,16β,21β,22α,23,28-hexol; (3β,4α,16β,21β,22α)-Olean-12-ene-3,16,21,22,23,28-hexol; |
| Molecular Formula | C30H50O6 |
| Purity | ≥95% |
| Target | Antibiotic |
| Storage | -20°C |
| IUPAC Name | (3R,4R,4aR,5S,6aR,6aS,6bR,8aR,9R,10S,12aR,14bS)-4a,9-bis(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-3,4,5,10-tetrol |
| InChI | InChI=1S/C30H50O6/c1-25(2)13-18-17-7-8-20-26(3)11-10-21(33)27(4,15-31)19(26)9-12-28(20,5)29(17,6)14-22(34)30(18,16-32)24(36)23(25)35/h7,18-24,31-36H,8-16H2,1-6H3/t18-,19+,20+,21-,22-,23-,24-,26-,27-,28+,29+,30-/m0/s1 |
| InChIKey | VKJLHZZPVLQJKG-ABHKXHSUSA-N |
| SMILES | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CC(C2(C(C1O)O)CO)O)C)C)(C)CO)O)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |