GSK/'872 - CAS 1346546-69-7

GSK/’872(Cat No.:I011913), is a chemical compound with potential pharmaceutical applications. It acts as a selective inhibitor, primarily targeting a specific protein or pathway in biological systems. While detailed information about its exact mechanism of action and therapeutic uses may vary, compounds like GSK/’872 are often explored in preclinical and clinical research for their ability to modulate specific cellular processes. Such compounds can hold promise for the development of novel drugs aimed at treating various diseases or conditions by selectively influencing specific molecular targets within the body’s complex biological networks.

Catalog Number: I011913

CAS Number: 1346546-69-7

Molecular Formula: C₁₉H₁₇N₃O₂S₂

Molecular Weight:383.49

Purity: ≥95%

* For research use only. Not for human or veterinary use.

Synonym

SynonymsGSK872; GSK-872; GSK 872;;N-5-benzothiazolyl-6-[(1-methylethyl)sulfonyl]-4-quinolinamine

Property

Molecular Formula: C₁₉H₁₇N₃O₂S₂
Molecular Weight383.49
Target:RIP3 inhibitor
SolubilitySoluble in DMSO
Purity≥95%
StorageRoom temperature

Computed Descriptor

IUPAC NameN-(6-propan-2-ylsulfonylquinolin-4-yl)-1,3-benzothiazol-5-amine
InChIInChI=1S/C19H17N3O2S2/c1-12(2)26(23,24)14-4-5-16-15(10-14)17(7-8-20-16)22-13-3-6-19-18(9-13)21-11-25-19/h3-12H,1-2H3,(H,20,22)
InChIKeyZCDBTQNFAPKACC-UHFFFAOYSA-N
SMILESCC(C)S(=O)(=O)C1=CC2=C(C=CN=C2C=C1)NC3=CC4=C(C=C3)SC=N4