For research use only. Not for therapeutic Use.
GSK3182571（Cat No.:I044376）is a selective inhibitor of the bromodomain-containing protein BRD4, a key player in gene expression regulation and cancer progression. By targeting BRD4, GSK3182571 disrupts oncogenic transcription programs, particularly in hematologic malignancies like acute myeloid leukemia. It shows high specificity for the second bromodomain (BD2) of BET proteins, reducing off-target effects. Preclinical studies highlight its potential to suppress MYC-driven tumor growth. This compound is a valuable tool for probing BET bromodomain biology and may support the development of targeted epigenetic therapies in cancer research and drug discovery.
| CAS Number | 2135595-04-7 |
| Synonyms | 2-[[2-[4-[4-(3-aminopropyl)piperazin-1-yl]anilino]-5-chloropyrimidin-4-yl]amino]-N-methylbenzamide |
| Molecular Formula | C25H31ClN8O |
| Purity | ≥95% |
| IUPAC Name | 2-[[2-[4-[4-(3-aminopropyl)piperazin-1-yl]anilino]-5-chloropyrimidin-4-yl]amino]-N-methylbenzamide |
| InChI | InChI=1S/C25H31ClN8O/c1-28-24(35)20-5-2-3-6-22(20)31-23-21(26)17-29-25(32-23)30-18-7-9-19(10-8-18)34-15-13-33(14-16-34)12-4-11-27/h2-3,5-10,17H,4,11-16,27H2,1H3,(H,28,35)(H2,29,30,31,32) |
| InChIKey | UJADJYISGUHANC-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=CC=C1NC2=NC(=NC=C2Cl)NC3=CC=C(C=C3)N4CCN(CC4)CCCN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
