For research use only. Not for therapeutic Use.
GSK2578215A (Cat.No:I001116) is a selective inhibitor of the protein kinase B (Akt) pathway, a critical signaling pathway involved in cell survival and proliferation. It has shown promising results in preclinical studies, inhibiting tumor growth and inducing apoptosis in various cancer cell lines. GSK2578215A is being investigated for its therapeutic potential in cancer treatment.
| CAS Number | 1285515-21-0 |
| Synonyms | 2-(benzyloxy)-5-(2-fluoropyridin-4-yl)-N-(pyridin-3-yl)benzamide |
| Molecular Formula | C24H18FN3O2 |
| Purity | ≥95% |
| Target | LRRK2 |
| Solubility | 10 mM in DMSO |
| Storage | Store at RT |
| IC50 | ~10 nM(wt-LRRK2; LRRK2 G2019S) |
| IUPAC Name | 5-(2-fluoropyridin-4-yl)-2-phenylmethoxy-N-pyridin-3-ylbenzamide |
| InChI | 1S/C24H18FN3O2/c25-23-14-19(10-12-27-23)18-8-9-22(30-16-17-5-2-1-3-6-17)21(13-18)24(29)28-20-7-4-11-26-15-20/h1-15H,16H2,(H,28,29) |
| InChIKey | WCIGMFCFPXZRMQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C3=CC(=NC=C3)F)C(=O)NC4=CN=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |