For research use only. Not for therapeutic Use.
GSK-A1（Cat No.:I028424）is a selective activator of AMP-activated protein kinase (AMPK), a key regulator of cellular energy homeostasis. Developed by GlaxoSmithKline, GSK-A1 targets AMPK to enhance glucose uptake, fatty acid oxidation, and mitochondrial biogenesis, making it a valuable tool in metabolic research. It is often used to study pathways involved in type 2 diabetes, obesity, and related metabolic disorders. Unlike indirect activators like metformin, GSK-A1 directly binds the AMPK β-subunit. Its potency and specificity allow detailed investigation of AMPK-mediated signaling in cellular and animal models.
| CAS Number | 1416334-69-4 |
| Synonyms | 5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-N-(2-fluorophenyl)-2-methoxypyridine-3-sulfonamide |
| Molecular Formula | C29H27FN6O4S |
| Purity | ≥95% |
| IUPAC Name | 5-[2-amino-3-(4-morpholin-4-ylphenyl)benzimidazol-5-yl]-N-(2-fluorophenyl)-2-methoxypyridine-3-sulfonamide |
| InChI | InChI=1S/C29H27FN6O4S/c1-39-28-27(41(37,38)34-24-5-3-2-4-23(24)30)17-20(18-32-28)19-6-11-25-26(16-19)36(29(31)33-25)22-9-7-21(8-10-22)35-12-14-40-15-13-35/h2-11,16-18,34H,12-15H2,1H3,(H2,31,33) |
| InChIKey | AJOGHKUZDLYXKS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)C2=CC3=C(C=C2)N=C(N3C4=CC=C(C=C4)N5CCOCC5)N)S(=O)(=O)NC6=CC=CC=C6F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
