GSK-2879552 (CAT: I001536) is an irreversible inhibitor of lysine-specific demethylase 1 (LSD1). LSD1 is an enzyme involved in the regulation of gene expression through histone demethylation. By inhibiting LSD1, GSK-2879552 can modulate gene expression patterns, potentially leading to antineoplastic effects. It has shown promise in preclinical studies as a therapeutic agent for the treatment of various cancers.
Catalog Number | I001536 |
CAS Number | 1401966-69-5 |
Synonyms | 4-((4-((((1R,2S)-2-phenylcyclopropyl)amino)methyl)piperidin-1-yl)methyl)benzoic acid |
Molecular Formula | C₂₃H₂₈N₂O₂.HCl |
Purity | ≥95% |
Target | Histone Demethylases |
Solubility | DMSO: 31 mg/mL |
Storage | Store at -20°C |
InChI | InChI=1S/C23H28N2O2/c26-23(27)20-8-6-18(7-9-20)16-25-12-10-17(11-13-25)15-24-22-14-21(22)19-4-2-1-3-5-19/h1-9,17,21-22,24H,10-16H2,(H,26,27) |
InChIKey | LRULVYSBRWUVGR-UHFFFAOYSA-N |
SMILES | C1CN(CCC1CNC2CC2C3=CC=CC=C3)CC4=CC=C(C=C4)C(=O)O |
Reference | <p style=/line-height:25px/> </p> |