For research use only. Not for therapeutic Use.
GRL-1720 TFA(CAT: I040299) is a potent small-molecule inhibitor targeting the main protease, also known as 3CL of SARS-CoV-2, a critical enzyme required for viral polyprotein processing and replication. With an EC₅₀ value of 15 μM, GRL-1720 TFA demonstrates significant antiviral activity against SARS-CoV-2 in vitro. Its mechanism of action involves direct inhibition of M enzymatic activity, thereby disrupting viral maturation. Supplied as a trifluoroacetate salt for enhanced stability and solubility, GRL-1720 TFA is a valuable research tool for antiviral drug development and mechanistic studies of coronavirus replication.
| Synonyms | (5-chloropyridin-3-yl) 2,3-dihydro-1H-indole-4-carboxylate;2,2,2-trifluoroacetic acid |
| Molecular Formula | C16H12ClF3N2O4 |
| Purity | ≥95% |
| IUPAC Name | (5-chloropyridin-3-yl) 2,3-dihydro-1H-indole-4-carboxylate;2,2,2-trifluoroacetic acid |
| InChI | InChI=1S/C14H11ClN2O2.C2HF3O2/c15-9-6-10(8-16-7-9)19-14(18)12-2-1-3-13-11(12)4-5-17-13;3-2(4,5)1(6)7/h1-3,6-8,17H,4-5H2;(H,6,7) |
| InChIKey | ISYUUWQBWRIXPZ-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC=CC(=C21)C(=O)OC3=CC(=CN=C3)Cl.C(=O)(C(F)(F)F)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
