For research use only. Not for therapeutic Use.
Granilin（Cat No.:I044794）is a bioactive triterpenoid compound derived from plants in the Phyllanthus genus, known for their use in traditional medicine. Structurally, granilin belongs to the oleanane-type triterpenes and has attracted attention for its anti-inflammatory, antioxidant, and potential anticancer properties. It has been shown to modulate cellular signaling pathways involved in inflammation and oxidative stress, making it a promising candidate for therapeutic research. Granilin is also being studied for its hepatoprotective and immunomodulatory effects. Its diverse pharmacological profile supports its potential role in natural product-based drug discovery and development.
| CAS Number | 40737-97-1 |
| Synonyms | (3aR,4aS,6R,8S,8aR,9aR)-6,8-dihydroxy-8a-methyl-3,5-dimethylidene-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| Molecular Formula | C15H20O4 |
| Purity | ≥95% |
| IUPAC Name | (3aR,4aS,6S,8R,8aR,9aR)-6,8-dihydroxy-8a-methyl-3,5-dimethylidene-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| InChI | InChI=1S/C15H20O4/c1-7-9-4-10-8(2)11(16)5-13(17)15(10,3)6-12(9)19-14(7)18/h9-13,16-17H,1-2,4-6H2,3H3/t9-,10+,11+,12-,13-,15-/m1/s1 |
| InChIKey | ZEIYNPAINVEWGP-NQHOMTGGSA-N |
| SMILES | C[C@@]12C[C@@H]3[C@H](C[C@H]1C(=C)[C@H](C[C@H]2O)O)C(=C)C(=O)O3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
