For research use only. Not for therapeutic Use.
GR-46611（Cat No.:M034464）is a selective small molecule inhibitor primarily studied for its potential in treating neurological disorders. It works by targeting specific receptors and enzymes involved in neuroinflammation and neuronal damage. By modulating key signaling pathways, GR-46611 aims to reduce inflammation and protect neuronal cells, which is beneficial in diseases such as Alzheimer’s disease, Parkinson’s disease, and other neurodegenerative conditions. Early preclinical studies suggest it may improve cognitive function and slow disease progression. Ongoing research focuses on its safety, efficacy, and possible application in various neurological disorders.
| CAS Number | 185259-85-2 |
| Synonyms | (E)-3-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
| Molecular Formula | C23H27N3O2 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
| InChI | InChI=1S/C23H27N3O2/c1-26(2)13-12-19-16-24-22-10-6-17(14-21(19)22)7-11-23(27)25-15-18-4-8-20(28-3)9-5-18/h4-11,14,16,24H,12-13,15H2,1-3H3,(H,25,27)/b11-7+ |
| InChIKey | LBVZWEWTNUDWNS-YRNVUSSQSA-N |
| SMILES | CN(C)CCC1=CNC2=C1C=C(C=C2)/C=C/C(=O)NCC3=CC=C(C=C3)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
