For research use only. Not for therapeutic Use.
GPR88 Agonist 2(CAT: I040675) is a selective small-molecule activator of G protein-coupled receptor 88 (GPR88), an orphan receptor predominantly expressed in the striatum of the brain. By stimulating GPR88 activity, this compound modulates dopaminergic, glutamatergic, and GABAergic neurotransmission, making it valuable for studying neuropsychiatric and neurological disorders. GPR88 Agonist 2 is commonly used in preclinical models to explore its potential in treating conditions such as schizophrenia, Parkinson’s disease, addiction, and anxiety. Its high specificity and brain-penetrant properties make it a powerful pharmacological tool for elucidating the physiological and therapeutic roles of GPR88 in the central nervous system.
| CAS Number | 2821859-71-4 |
| Synonyms | N-methyl-1-[(2R)-2-[4-[(2S)-2-methylbutoxy]phenyl]-2-[[(2S)-2-phenylpropanoyl]amino]ethyl]triazole-4-carboxamide |
| Molecular Formula | C26H33N5O3 |
| Purity | ≥95% |
| IUPAC Name | N-methyl-1-[(2R)-2-[4-[(2S)-2-methylbutoxy]phenyl]-2-[[(2S)-2-phenylpropanoyl]amino]ethyl]triazole-4-carboxamide |
| InChI | InChI=1S/C26H33N5O3/c1-5-18(2)17-34-22-13-11-21(12-14-22)23(15-31-16-24(29-30-31)26(33)27-4)28-25(32)19(3)20-9-7-6-8-10-20/h6-14,16,18-19,23H,5,15,17H2,1-4H3,(H,27,33)(H,28,32)/t18-,19-,23-/m0/s1 |
| InChIKey | LVUMROGMIIBKQA-YDHSSHFGSA-N |
| SMILES | CCC(C)COC1=CC=C(C=C1)C(CN2C=C(N=N2)C(=O)NC)NC(=O)C(C)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
