For research use only. Not for therapeutic Use.
GPR40 agonist 6（Cat No.:I043375）is a small molecule designed to selectively activate the GPR40 receptor, a G-protein-coupled receptor primarily expressed in pancreatic beta cells. This receptor plays a crucial role in enhancing insulin secretion in response to free fatty acids. By binding to GPR40, Agonist 6 can potentially improve insulin sensitivity and glucose control, making it a promising candidate for the treatment of type 2 diabetes. Its mechanism aims to promote insulin release in a glucose-dependent manner, offering a targeted approach to managing blood sugar levels and improving metabolic health.
| CAS Number | 1798751-25-3 |
| Synonyms | 3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propanoic acid |
| Molecular Formula | C20H19NO4 |
| Purity | ≥95% |
| IUPAC Name | 3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propanoic acid |
| InChI | InChI=1S/C20H19NO4/c1-14-18(21-20(25-14)16-5-3-2-4-6-16)13-24-17-10-7-15(8-11-17)9-12-19(22)23/h2-8,10-11H,9,12-13H2,1H3,(H,22,23) |
| InChIKey | BVILYIQBHXIHEN-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CC=C2)COC3=CC=C(C=C3)CCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
