For research use only. Not for therapeutic Use.
GPR30 Agonist-1（Cat No.:I044578）is a selective small-molecule agonist of G protein-coupled estrogen receptor 1 (GPER1/GPR30), a membrane-associated receptor involved in rapid, non-genomic estrogen signaling. By specifically activating GPR30, this compound modulates pathways linked to cell proliferation, apoptosis, and hormone regulation, without engaging classical nuclear estrogen receptors (ERα/ERβ). It is widely used in studies of estrogen-related physiology and pathologies, including breast cancer, cardiovascular function, and metabolic disorders. GPR30 Agonist-1 provides a powerful tool for dissecting estrogen signaling mechanisms and for developing targeted therapies that exploit non-genomic hormone pathways.
| CAS Number | 415919-74-3 |
| Synonyms | (3aS,4R,9bR)-4-(5-bromo-2-methoxyphenyl)-8-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| Molecular Formula | C19H17BrFNO |
| Purity | ≥95% |
| IUPAC Name | (3aS,4R,9bR)-4-(5-bromo-2-methoxyphenyl)-8-fluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| InChI | InChI=1S/C19H17BrFNO/c1-23-18-8-5-11(20)9-16(18)19-14-4-2-3-13(14)15-10-12(21)6-7-17(15)22-19/h2-3,5-10,13-14,19,22H,4H2,1H3/t13-,14+,19-/m1/s1 |
| InChIKey | YGLAUQAYNBUDIJ-BIENJYKASA-N |
| SMILES | COC1=C(C=C(C=C1)Br)[C@H]2[C@H]3CC=C[C@H]3C4=C(N2)C=CC(=C4)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
