For research use only. Not for therapeutic Use.
GPR109 Receptor Agonist-2(CAT: I040648) is a synthetic small molecule that selectively activates the GPR109A (also known as HCAR2) receptor, a G-protein-coupled receptor involved in lipid metabolism, anti-inflammatory responses, and immune modulation. This compound mimics the action of endogenous ligands like niacin and β-hydroxybutyrate, making it valuable for research in metabolic disorders, neuroinflammation, and cardiovascular diseases. GPR109 agonists have shown promise in lowering plasma free fatty acids and suppressing pro-inflammatory cytokines. Agonist-2 is commonly used in in vitro and in vivo studies to investigate receptor signaling, gene expression regulation, and therapeutic pathways.
| CAS Number | 957129-38-3 |
| Synonyms | 5-ethyl-4-methyl-1H-pyrazole-3-carboxylic acid |
| Molecular Formula | C7H10N2O2 |
| Purity | ≥95% |
| IUPAC Name | 5-ethyl-4-methyl-1H-pyrazole-3-carboxylic acid |
| InChI | InChI=1S/C7H10N2O2/c1-3-5-4(2)6(7(10)11)9-8-5/h3H2,1-2H3,(H,8,9)(H,10,11) |
| InChIKey | MFNJGDMJKJLUGC-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=NN1)C(=O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
