For research use only. Not for therapeutic Use.
Golcadomide (Cat No.:I043557) is an investigational immunomodulatory drug being developed by Celgene (now part of Bristol-Myers Squibb). It belongs to a class of compounds called cereblon modulators, which have a mechanism of action that involves targeting specific proteins within cells to modulate immune responses. Golcadomide is being studied primarily for its potential in treating multiple myeloma and other hematologic cancers. By inhibiting tumor cell survival and promoting the degradation of oncogenic proteins, Golcadomide shows promise as an effective therapeutic agent in cancer treatment.
| CAS Number | 2379572-34-4 |
| Synonyms | 2-[(3S)-2,6-dioxopiperidin-3-yl]-4-[[2-fluoro-4-[(3-morpholin-4-ylazetidin-1-yl)methyl]phenyl]methylamino]isoindole-1,3-dione |
| Molecular Formula | C28H30FN5O5 |
| Purity | ≥95% |
| IUPAC Name | 2-[(3S)-2,6-dioxopiperidin-3-yl]-4-[[2-fluoro-4-[(3-morpholin-4-ylazetidin-1-yl)methyl]phenyl]methylamino]isoindole-1,3-dione |
| InChI | InChI=1S/C28H30FN5O5/c29-21-12-17(14-32-15-19(16-32)33-8-10-39-11-9-33)4-5-18(21)13-30-22-3-1-2-20-25(22)28(38)34(27(20)37)23-6-7-24(35)31-26(23)36/h1-5,12,19,23,30H,6-11,13-16H2,(H,31,35,36)/t23-/m0/s1 |
| InChIKey | NZYDBVQXOGPDDU-QHCPKHFHSA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2C(=O)C3=C(C2=O)C(=CC=C3)NCC4=C(C=C(C=C4)CN5CC(C5)N6CCOCC6)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
