For research use only. Not for therapeutic Use.
GnRH Antagonist 2（Cat No.:I044535）is a synthetic small-molecule compound designed to inhibit gonadotropin-releasing hormone (GnRH) receptors, thereby suppressing the release of luteinizing hormone (LH) and follicle-stimulating hormone (FSH) from the pituitary gland. This leads to a rapid and reversible reduction in sex hormone production, including testosterone and estrogen. GnRH Antagonist 2 is primarily used in research related to hormone-sensitive conditions such as prostate cancer, endometriosis, and uterine fibroids. Its fast-acting, non-surge mechanism offers advantages over GnRH agonists, making it a valuable tool for studying and developing hormonal therapies.
| CAS Number | 1709823-61-9 |
| Synonyms | 1-[4-[7-[(2,6-difluorophenyl)methyl]-3-[(dimethylamino)methyl]-5-(6-methoxypyridazin-3-yl)-4,6-dioxopyrazolo[3,4-d]pyrimidin-2-yl]phenyl]-3-methoxyurea |
| Molecular Formula | C28H27F2N9O5 |
| Purity | ≥95% |
| IUPAC Name | 1-[4-[7-[(2,6-difluorophenyl)methyl]-3-[(dimethylamino)methyl]-5-(6-methoxypyridazin-3-yl)-4,6-dioxopyrazolo[3,4-d]pyrimidin-2-yl]phenyl]-3-methoxyurea |
| InChI | InChI=1S/C28H27F2N9O5/c1-36(2)15-21-24-25(34-39(21)17-10-8-16(9-11-17)31-27(41)35-44-4)37(14-18-19(29)6-5-7-20(18)30)28(42)38(26(24)40)22-12-13-23(43-3)33-32-22/h5-13H,14-15H2,1-4H3,(H2,31,35,41) |
| InChIKey | IMJPTZZFUZNJLV-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C2C(=NN1C3=CC=C(C=C3)NC(=O)NOC)N(C(=O)N(C2=O)C4=NN=C(C=C4)OC)CC5=C(C=CC=C5F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
