For research use only. Not for therapeutic Use.
GNE-149（Cat No.:I028175）is an investigational small-molecule inhibitor targeting O-GlcNAc transferase (OGT), a key enzyme that catalyzes the addition of O-linked N-acetylglucosamine (O-GlcNAc) to serine and threonine residues on nuclear and cytoplasmic proteins. By inhibiting OGT, GNE-149 disrupts cellular processes such as transcription, signal transduction, and stress response—pathways often dysregulated in cancer and metabolic diseases. It serves as a valuable chemical probe for studying the role of O-GlcNAcylation in cell biology and disease. Supplied for research into post-translational modifications, epigenetic regulation, and therapeutic target validation.
| CAS Number | 1953132-75-6 |
| Synonyms | (1R,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| Molecular Formula | C28H33F4N3O |
| Purity | ≥95% |
| IUPAC Name | (1R,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| InChI | InChI=1S/C28H33F4N3O/c1-17-11-21-20-7-4-5-8-24(20)33-26(21)27(35(17)16-28(2,3)32)25-22(30)12-18(13-23(25)31)36-19-14-34(15-19)10-6-9-29/h4-5,7-8,12-13,17,19,27,33H,6,9-11,14-16H2,1-3H3/t17-,27-/m1/s1 |
| InChIKey | BKHIBYHLBQEIQK-XGCWNURASA-N |
| SMILES | C[C@@H]1CC2=C([C@H](N1CC(C)(C)F)C3=C(C=C(C=C3F)OC4CN(C4)CCCF)F)NC5=CC=CC=C25 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
