For research use only. Not for therapeutic Use.
Glyphosate-isopropylammonium (Cat.No:R069454) is the isopropylammonium salt of glyphosate, a widely used herbicide. It inhibits the EPSP synthase enzyme, essential for plant growth, leading to weed control. This compound is a key component in many herbicide formulations and is valuable in agricultural and forestry practices for effective weed management.
| CAS Number | 38641-94-0 |
| Synonyms | Glycel(TM), Glyphosate isopropylamine salt, Mono-isopropylammoniova sul, Nitosorg(TM), Rattler(TM) |
| Molecular Formula | C6H17N2O5P |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 2-(phosphonomethylamino)acetic acid;propan-2-amine |
| InChI | InChI=1S/C3H8NO5P.C3H9N/c5-3(6)1-4-2-10(7,8)9;1-3(2)4/h4H,1-2H2,(H,5,6)(H2,7,8,9);3H,4H2,1-2H3 |
| InChIKey | ZEKANFGSDXODPD-UHFFFAOYSA-N |
| SMILES | CC(C)N.C(C(=O)O)NCP(=O)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |