For research use only. Not for therapeutic Use.
Glyoxalbis(2-hydroxyanil) (Cat.No:M050316) is a chemical compound used in analytical chemistry as a reagent for the spectrophotometric determination of certain metal ions. Its complex-forming properties make it valuable in detecting and quantifying metals like nickel and cobalt. Glyoxalbis(2-hydroxyanil) aids in accurate metal analysis and research applications.
CAS Number | 1149-16-2 |
Molecular Formula | C14H12N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-[(E)-2-(2-hydroxyanilino)ethenyl]iminocyclohexa-2,4-dien-1-one |
InChI | InChI=1S/C14H12N2O2/c17-13-7-3-1-5-11(13)15-9-10-16-12-6-2-4-8-14(12)18/h1-10,15,17H/b10-9+,16-12? |
InChIKey | OMJNMRJMNUREOJ-KOBPNRPCSA-N |
SMILES | C1=CC=C(C(=C1)NC=CN=C2C=CC=CC2=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |