For research use only. Not for therapeutic Use.
Glycyl-L-glutamine monohydrate (Cat.No:M063277) is a dipeptide compound consisting of the amino acids glycine and glutamine, typically in its monohydrate form. It’s utilized in various fields, including biotechnology and pharmaceuticals, as a component in cell culture media and protein formulations, aiding in the growth and stability of cell cultures and proteins.
| CAS Number | 13115-71-4 |
| Molecular Formula | C7H13N3O4 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | (2S)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoic acid |
| InChI | InChI=1S/C7H13N3O4/c8-3-6(12)10-4(7(13)14)1-2-5(9)11/h4H,1-3,8H2,(H2,9,11)(H,10,12)(H,13,14)/t4-/m0/s1 |
| InChIKey | PNMUAGGSDZXTHX-BYPYZUCNSA-N |
| SMILES | C(CC(=O)N)C(C(=O)O)NC(=O)CN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |