For research use only. Not for therapeutic Use.
Glycitein(Cat No.:I003490) is an isoflavonoid found in yellow cultivar soybeans. It is often used in combination with other isoflavonoids like genistein and daidzein to study processes such as apoptosis (programmed cell death) and anti-oxidation. By combining these isoflavonoids, researchers can investigate their potential synergistic effects and explore their roles in various cellular processes. Glycitein offers a valuable tool for studying the bioactive properties of soy isoflavonoids and their potential applications in areas such as cancer research and oxidative stress.
| CAS Number | 40957-83-3 |
| Synonyms | 7-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one |
| Molecular Formula | C16H12O5 |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | 7-hydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one |
| InChI | InChI=1S/C16H12O5/c1-20-15-6-11-14(7-13(15)18)21-8-12(16(11)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| InChIKey | DXYUAIFZCFRPTH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C(=CO2)C3=CC=C(C=C3)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |