Glycidyl methacrylate(Cat No.:M067399) is a versatile organic compound characterized by its dual functionality: it has both an epoxy group and a methacrylate group. This combination enables it to undergo polymerization and cross-linking, making it a valuable monomer in the production of various polymers and copolymers. It is widely used in the manufacture of coatings, adhesives, and plastics that require improved strength, adhesion, and chemical resistance. Additionally, glycidyl methacrylate is utilized in the dental industry for making precise and durable dental prosthetics and composites.
Catalog Number | M067399 |
CAS Number | 106-91-2 |
Molecular Formula | C7H10O3 |
Purity | 95% |
Storage | Store at RT |
IUPAC Name | oxiran-2-ylmethyl 2-methylprop-2-enoate |
InChI | InChI=1S/C7H10O3/c1-5(2)7(8)10-4-6-3-9-6/h6H,1,3-4H2,2H3 |
InChIKey | VOZRXNHHFUQHIL-UHFFFAOYSA-N |
SMILES | CC(=C)C(=O)OCC1CO1 |