For research use only. Not for therapeutic Use.
Glychionide A（Cat No.:I044846）is a flavonoid glycoside isolated from Glycyrrhiza species, particularly Glycyrrhiza glabra (licorice), widely used in traditional medicine. It consists of a flavone aglycone linked to sugar moieties, enhancing its water solubility and pharmacokinetic properties. Glychionide A exhibits diverse biological activities, including antioxidant, anti-inflammatory, hepatoprotective, and antiviral effects. Its pharmacological action is attributed to the modulation of oxidative stress pathways and inhibition of pro-inflammatory mediators. As part of licorice’s complex phytochemical profile, Glychionide A contributes to the herb’s therapeutic efficacy and is under investigation for applications in liver protection and immune regulation.
| CAS Number | 119152-50-0 |
| Synonyms | (2S,3S,4S,5R,6S)-6-(5,8-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Molecular Formula | C21H18O11 |
| Purity | ≥95% |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-(5,8-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChI | InChI=1S/C21H18O11/c22-9-6-11(8-4-2-1-3-5-8)30-18-13(9)10(23)7-12(14(18)24)31-21-17(27)15(25)16(26)19(32-21)20(28)29/h1-7,15-17,19,21,23-27H,(H,28,29)/t15-,16-,17+,19-,21+/m0/s1 |
| InChIKey | MOFOLNOWFPVLGZ-BHWDSYMASA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C=C3O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
