Glycerol ethoxylate（Cat No.:M015119） is a nonionic surfactant derived from glycerol, a natural triol, by ethoxylation—a process in which ethylene oxide is added to glycerol. This chemical modification significantly enhances glycerol’s solubility in water and its ability to interact with hydrophilic and lipophilic substances, making glycerol ethoxylate an effective emulsifier and wetting agent. It is widely used in various industries including cosmetics, pharmaceuticals, and household cleaning products. The versatility of glycerol ethoxylate also extends to its use as a lubricant and a viscosity modifier, improving the texture and stability of products.
| Catalog Number | M015119 |
| CAS Number | 31694-55-0 |
| Synonyms | GLYCEROL ETHOXYLATE;1,2,3-Propanetriol,ethoxylated;1,2,3-Propanetriol,polymerwithoxirane;2-ethanediyl),.alpha.,.alpha.’,.alpha.’’-1,2,3-propanetriyltris[.omega.-hydroxy-Poly(oxy-1;Ethoxylatedglycerin;Ethoxylatedglycerine;Glycerin,ethyleneoxidecondens |
| Molecular Formula | C9H20O6 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-[2,3-bis(2-hydroxyethoxy)propoxy]ethanol |
| InChI | InChI=1S/C9H20O6/c10-1-4-13-7-9(15-6-3-12)8-14-5-2-11/h9-12H,1-8H2 |
| InChIKey | UCYLROVJSUACAD-UHFFFAOYSA-N |
| SMILES | C(COCC(COCCO)OCCO)O |
