Glycerol 1,3-dimethacrylate (Cat No.:M122822) is a chemical compound with the formula C11H16O5. It is a viscous liquid that is used as a crosslinking agent in the production of dental materials, adhesives, and coatings. GDMA is a diacrylate derivative of glycerol, meaning it has two methacrylate groups attached to the glycerol backbone. These methacrylate groups can undergo polymerization reactions, linking GDMA molecules together to form a three-dimensional polymer network. This network provides strength and durability to the final product. GDMA is valued for its ability to improve the mechanical and adhesive properties of polymers, making it a key ingredient in various industrial applications.
| Catalog Number | M122822 |
| CAS Number | 1830-78-0 |
| Molecular Formula | C11H16O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
| InChI | InChI=1S/C11H16O5/c1-7(2)10(13)15-5-9(12)6-16-11(14)8(3)4/h9,12H,1,3,5-6H2,2,4H3 |
| InChIKey | OQHMGFSAURFQAF-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(COC(=O)C(=C)C)O |
