For research use only. Not for therapeutic Use.
Gly-7-MAD-MDCPT(Cat No.:I042663)is a synthetic compound designed for potential use in cancer therapeutics. It belongs to a class of molecules that function as targeted agents, aiming to inhibit tumor cell growth and proliferation. By interacting with specific molecular pathways, Gly-7-MAD-MDCPT works to disrupt cellular processes that are essential for cancer cell survival. Its structure includes modifications that enhance stability and potency against certain cancer types. Early-stage research suggests that it could be an effective treatment option for cancers resistant to conventional therapies, though more studies are needed to confirm its clinical efficacy.
CAS Number | 2378427-68-8 |
Synonyms | 2-amino-N-[[(5S)-5-ethyl-5-hydroxy-6,10-dioxo-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaen-14-yl]methyl]acetamide |
Molecular Formula | C24H22N4O7 |
Purity | ≥95% |
IUPAC Name | 2-amino-N-[[(5S)-5-ethyl-5-hydroxy-6,10-dioxo-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaen-14-yl]methyl]acetamide |
InChI | InChI=1S/C24H22N4O7/c1-2-24(32)15-4-17-21-13(8-28(17)22(30)14(15)9-33-23(24)31)12(7-26-20(29)6-25)11-3-18-19(35-10-34-18)5-16(11)27-21/h3-5,32H,2,6-10,25H2,1H3,(H,26,29)/t24-/m0/s1 |
InChIKey | LSGAIOTZJXLIGC-DEOSSOPVSA-N |
SMILES | CC[C@@]1(C2=C(COC1=O)C(=O)N3CC4=C(C5=CC6=C(C=C5N=C4C3=C2)OCO6)CNC(=O)CN)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |