For research use only. Not for therapeutic Use.
Glutarimide-Isoindolinone-NH-PEG4-COOH(Cat No.:I044476)is a PROTAC (proteolysis-targeting chimera) building block that combines a cereblon (CRBN)-binding moiety with a PEG4 (tetraethylene glycol) linker and a terminal carboxylic acid group for conjugation. The glutarimide-isoindolinone core mimics the pharmacophore of thalidomide, enabling high-affinity binding to the CRBN E3 ubiquitin ligase. The PEG4 linker offers improved solubility, flexibility, and spatial arrangement, optimizing ternary complex formation between CRBN and the protein of interest. This compound is widely used in the synthesis of bifunctional degraders in targeted protein degradation research and therapeutic development in oncology and beyond.
| CAS Number | 2927334-86-7 |
| Synonyms | 3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| Molecular Formula | C24H33N3O9 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C24H33N3O9/c28-21-4-3-20(23(31)26-21)27-16-17-15-18(1-2-19(17)24(27)32)25-6-8-34-10-12-36-14-13-35-11-9-33-7-5-22(29)30/h1-2,15,20,25H,3-14,16H2,(H,29,30)(H,26,28,31) |
| InChIKey | ZZCLCBLIVUGNOP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)NCCOCCOCCOCCOCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |