For research use only. Not for therapeutic Use.
GluN2B-NMDAR antagonist-1（Cat No.:I041224）is a selective inhibitor targeting the GluN2B subunit of the N-methyl-D-aspartate receptor (NMDAR). NMDARs play a crucial role in synaptic plasticity, learning, and memory, with the GluN2B subunit contributing to excitatory neurotransmission. By blocking GluN2B-containing NMDARs, this compound can modulate excessive neuronal activity associated with various neurological disorders such as Alzheimer’s disease, stroke, and neurodegenerative conditions. GluN2B-NMDAR antagonist-1 is being explored as a potential therapeutic agent to reduce excitotoxicity and neuroinflammation, offering a novel approach in the treatment of CNS disorders.
| Synonyms | (E)-N-[2-[1-[(3-bromophenyl)methyl]indol-3-yl]ethyl]-3-(4-hydroxyphenyl)prop-2-enamide |
| Molecular Formula | C26H23BrN2O2 |
| Purity | ≥95% |
| IUPAC Name | (E)-N-[2-[1-[(3-bromophenyl)methyl]indol-3-yl]ethyl]-3-(4-hydroxyphenyl)prop-2-enamide |
| InChI | InChI=1S/C26H23BrN2O2/c27-22-5-3-4-20(16-22)17-29-18-21(24-6-1-2-7-25(24)29)14-15-28-26(31)13-10-19-8-11-23(30)12-9-19/h1-13,16,18,30H,14-15,17H2,(H,28,31)/b13-10+ |
| InChIKey | CQRLHYONIXGPET-JLHYYAGUSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC3=CC(=CC=C3)Br)CCNC(=O)/C=C/C4=CC=C(C=C4)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
