Calcium gluconate is the calcium salt of gluconic acid. Calcium gluconate is an important organic calcium, mainly used as food calcium fortifier and nutrition, buffer, curing agent, chelating agent, the application prospect is very broad.
| Catalog Number | I003036 |
| CAS Number | 299-28-5 |
| Molecular Formula | C12H24CaO14+2 |
| Purity | 95% |
| Solubility | H2O: 30 mg/mL |
| Storage | Store at RT |
| IUPAC Name | calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI | InChI=1S/2C6H12O7.Ca/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1 |
| InChIKey | NEEHYRZPVYRGPP-IYEMJOQQSA-L |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
| Reference | <p style=/line-height:25px/> |
