For research use only. Not for therapeutic Use.
GLS-1-IN-1（Cat No.:I043877）is a selective inhibitor of glutaminase 1 (GLS-1), an enzyme involved in the conversion of glutamine to glutamate, a key metabolic pathway that supports cellular growth and energy production. GLS-1 is often overexpressed in various cancer types, promoting tumor growth and survival by enhancing glutamine metabolism. By inhibiting GLS-1, GLS-1-IN-1 may disrupt the metabolic processes that tumors rely on, making it a promising candidate for cancer therapy. Ongoing research is focused on evaluating its efficacy in inhibiting tumor growth and its potential as a targeted treatment for metabolic-dependent cancers.
| CAS Number | 1853164-83-6 |
| Synonyms | 4-[3-[3-[2-(5-fluoro-1H-indol-3-yl)-1,3-thiazol-4-yl]indol-1-yl]propyl]morpholine |
| Molecular Formula | C26H25FN4OS |
| Purity | ≥95% |
| IUPAC Name | 4-[3-[3-[2-(5-fluoro-1H-indol-3-yl)-1,3-thiazol-4-yl]indol-1-yl]propyl]morpholine |
| InChI | InChI=1S/C26H25FN4OS/c27-18-6-7-23-20(14-18)21(15-28-23)26-29-24(17-33-26)22-16-31(25-5-2-1-4-19(22)25)9-3-8-30-10-12-32-13-11-30/h1-2,4-7,14-17,28H,3,8-13H2 |
| InChIKey | WDUNBRCZIUIVHA-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCCN2C=C(C3=CC=CC=C32)C4=CSC(=N4)C5=CNC6=C5C=C(C=C6)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
