For research use only. Not for therapeutic Use.
GLP-1R modulator C5（Cat No.:I045233）is a selective small-molecule compound that targets the glucagon-like peptide-1 receptor (GLP-1R), a crucial mediator of glucose metabolism and appetite regulation. By modulating receptor signaling, C5 enhances glucose-dependent insulin secretion, reduces glucagon release, and may influence satiety and gastric emptying rates. Its mode of action aims to provide therapeutic benefits for type 2 diabetes and obesity research, potentially with fewer side effects than full agonists. C5 serves as a valuable research tool for investigating metabolic pathways and developing innovative treatments for endocrine and metabolic disorders.
| CAS Number | 421578-93-0 |
| Synonyms | 3-hydroxy-3-phenacyl-1-(2-phenylethyl)indol-2-one |
| Molecular Formula | C24H21NO3 |
| Purity | ≥95% |
| IUPAC Name | 3-hydroxy-3-phenacyl-1-(2-phenylethyl)indol-2-one |
| InChI | InChI=1S/C24H21NO3/c26-22(19-11-5-2-6-12-19)17-24(28)20-13-7-8-14-21(20)25(23(24)27)16-15-18-9-3-1-4-10-18/h1-14,28H,15-17H2 |
| InChIKey | QSAOBVACSHPJMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCN2C3=CC=CC=C3C(C2=O)(CC(=O)C4=CC=CC=C4)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
