For research use only. Not for therapeutic Use.
GLP-1 receptor agonist 11(Cat No.:I041068)is a synthetic peptide designed to activate the glucagon-like peptide 1 (GLP-1) receptor, which plays a crucial role in regulating glucose metabolism, insulin secretion, and appetite. By stimulating the GLP-1 receptor, this agonist improves insulin sensitivity, reduces blood glucose levels, and promotes weight loss. GLP-1 receptor agonist 11 is being studied for its therapeutic potential in managing type 2 diabetes and obesity. Its benefits include enhanced glucose control, reduced risk of cardiovascular events, and improved metabolic health, making it a promising candidate for metabolic disease treatment.
CAS Number | 2784590-83-4 |
Synonyms | 2-[[4-[2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]piperidin-1-yl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylic acid |
Molecular Formula | C31H31ClFN3O4 |
Purity | ≥95% |
IUPAC Name | 2-[[4-[2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]piperidin-1-yl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylic acid |
InChI | InChI=1S/C31H31ClFN3O4/c32-23-7-5-22(26(33)16-23)19-40-29-4-2-1-3-25(29)20-9-12-35(13-10-20)18-30-34-27-8-6-21(31(37)38)15-28(27)36(30)17-24-11-14-39-24/h1-8,15-16,20,24H,9-14,17-19H2,(H,37,38)/t24-/m0/s1 |
InChIKey | BWGRQMSFZQCDNS-DEOSSOPVSA-N |
SMILES | C1CO[C@@H]1CN2C3=C(C=CC(=C3)C(=O)O)N=C2CN4CCC(CC4)C5=CC=CC=C5OCC6=C(C=C(C=C6)Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |