For research use only. Not for therapeutic Use.
Gliotoxin (Cat No.: R040030) is a secondary metabolite produced by various fungi, including Aspergillus species. It is a potent immunosuppressive compound that inhibits immune cell activity, particularly affecting T cells and macrophages. Gliotoxin works by inducing apoptosis in immune cells and disrupting cellular functions, which makes it of interest in both pathogenicity studies and potential therapeutic applications. While it plays a role in fungal virulence, gliotoxin’s toxic properties and effects on the immune system also make it a subject of concern in clinical research.
| CAS Number | 67-99-2 |
| Synonyms | (3R,5aS,6S,10aR)-2,3,5a,6-Tetrahydro-6-hydroxy-3-(hydroxymethyl)-2-methyl-10H-3,10a-epidithiopyrazino[1,2-a]indole-1,4-dione |
| Molecular Formula | C13H14N2O4S2 |
| Purity | ≥95% |
| Target | TGF-beta/Smad |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Desiccate at -20°C |
| IUPAC Name | (1R,7S,8S,11R)-7-hydroxy-11-(hydroxymethyl)-15-methyl-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5-diene-10,14-dione |
| InChI | InChI=1S/C13H14N2O4S2/c1-14-10(18)12-5-7-3-2-4-8(17)9(7)15(12)11(19)13(14,6-16)21-20-12/h2-4,8-9,16-17H,5-6H2,1H3/t8-,9-,12+,13+/m0/s1 |
| InChIKey | FIVPIPIDMRVLAY-RBJBARPLSA-N |
| SMILES | CN1C(=O)C23CC4=CC=CC(C4N2C(=O)C1(SS3)CO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |