For research use only. Not for therapeutic Use.
Glemanserin（Cat No.:M008390）is a selective antagonist targeting serotonin 5-HT₂A receptors, recognized for its therapeutic potential in neurological and psychiatric research. By effectively inhibiting 5-HT₂A receptor activity, Glemanserin modulates serotonin signaling pathways associated with mood disorders, anxiety, and cognitive dysfunction. It is extensively utilized in experimental studies aiming to clarify receptor-specific mechanisms and evaluate therapeutic strategies for conditions like depression, schizophrenia, anxiety disorders, and insomnia. Its specificity and favorable pharmacological profile enable precise investigation into serotonergic system modulation, providing valuable insights into receptor functions and potential drug development avenues for psychiatric and neurological diseases.
| CAS Number | 107703-78-6 |
| Synonyms | phenyl-[1-(2-phenylethyl)piperidin-4-yl]methanol |
| Molecular Formula | C20H25NO |
| Purity | ≥95% |
| IUPAC Name | phenyl-[1-(2-phenylethyl)piperidin-4-yl]methanol |
| InChI | InChI=1S/C20H25NO/c22-20(18-9-5-2-6-10-18)19-12-15-21(16-13-19)14-11-17-7-3-1-4-8-17/h1-10,19-20,22H,11-16H2 |
| InChIKey | AXNGJCOYCMDPQG-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(C2=CC=CC=C2)O)CCC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
