For research use only. Not for therapeutic Use.
Glabrescione B（Cat No.:I015002）is a natural isoflavone derivative isolated from Derris glabrescens, recognized for its unique ability to directly target the transcription factor Gli1, a key effector in the Hedgehog (Hh) signaling pathway. By binding to Gli1, Glabrescione B disrupts its transcriptional activity, making it a valuable small-molecule inhibitor for studying Hh-dependent cancers such as medulloblastoma and basal cell carcinoma. Beyond oncology, it provides insight into developmental biology and signal transduction. Its natural origin and novel mechanism highlight its potential as both a research probe and therapeutic lead.
| CAS Number | 65893-94-9 |
| Synonyms | 3-[3,4-bis(3-methylbut-2-enoxy)phenyl]-5,7-dimethoxychromen-4-one |
| Molecular Formula | C27H30O6 |
| Purity | ≥95% |
| IUPAC Name | 3-[3,4-bis(3-methylbut-2-enoxy)phenyl]-5,7-dimethoxychromen-4-one |
| InChI | InChI=1S/C27H30O6/c1-17(2)9-11-31-22-8-7-19(13-23(22)32-12-10-18(3)4)21-16-33-25-15-20(29-5)14-24(30-6)26(25)27(21)28/h7-10,13-16H,11-12H2,1-6H3 |
| InChIKey | RHXDATRKLOYVTC-UHFFFAOYSA-N |
| SMILES | CC(=CCOC1=C(C=C(C=C1)C2=COC3=C(C2=O)C(=CC(=C3)OC)OC)OCC=C(C)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
