For research use only. Not for therapeutic Use.
GGTI-2154 hydrochloride（Cat No.:I045066）is a potent inhibitor of geranylgeranyltransferase I (GGTase I), an enzyme involved in the post-translational modification of proteins through geranylgeranylation. This modification is essential for the proper localization and function of small GTPases like Rho, Rac, and Cdc42, which regulate cell growth, differentiation, and survival. By inhibiting GGTase I, GGTI-2154 hydrochloride disrupts these signaling pathways, showing potential in anticancer therapy by impairing tumor cell proliferation and metastasis. The hydrochloride salt enhances compound solubility and stability, making it suitable for biochemical and cellular studies in cancer research.
| CAS Number | 478908-50-8 |
| Synonyms | (2S)-2-[[4-(1H-imidazol-5-ylmethylamino)-2-(2-methylphenyl)benzoyl]amino]-4-methylpentanoic acid;hydrochloride |
| Molecular Formula | C24H29ClN4O3 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[[4-(1H-imidazol-5-ylmethylamino)-2-(2-methylphenyl)benzoyl]amino]-4-methylpentanoic acid;hydrochloride |
| InChI | InChI=1S/C24H28N4O3.ClH/c1-15(2)10-22(24(30)31)28-23(29)20-9-8-17(26-13-18-12-25-14-27-18)11-21(20)19-7-5-4-6-16(19)3;/h4-9,11-12,14-15,22,26H,10,13H2,1-3H3,(H,25,27)(H,28,29)(H,30,31);1H/t22-;/m0./s1 |
| InChIKey | JQRKKNPKMYXQRS-FTBISJDPSA-N |
| SMILES | CC1=CC=CC=C1C2=C(C=CC(=C2)NCC3=CN=CN3)C(=O)N[C@@H](CC(C)C)C(=O)O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
